C17H30O7 — CID 159124417
(3R,6S,7R,8S,9R)-3-hexyl-6,7,8,9-tetrahydroxyundecane-2,5,10-trione (PubChem CID 159124417) has the molecular formula C17H30O7 and a molecular weight of 346.42 g/mol. Its IUPAC name is (3R,6S,7R,8S,9R)-3-hexyl-6,7,8,9-tetrahydroxyundecane-2,5,10-trione.
| Compound Name | (3R,6S,7R,8S,9R)-3-hexyl-6,7,8,9-tetrahydroxyundecane-2,5,10-trione |
|---|---|
| PubChem CID | 159124417 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | (3R,6S,7R,8S,9R)-3-hexyl-6,7,8,9-tetrahydroxyundecane-2,5,10-trione |
| SMILES | CCCCCCC(CC(=O)[C@@H](O)[C@H](O)[C@H](O)[C@@H](O)C(C)=O)C(C)=O |
| InChI | InChI=1S/C17H30O7/c1-4-5-6-7-8-12(10(2)18)9-13(20)15(22)17(24)16(23)14(21)11(3)19/h12,14-17,21-24H,4-9H2,1-3H3/t12?,14-,15+,16+,17-/m0/s1 |
| InChIKey | CHSZVRBKCQYFAC-YIYHNIHFSA-N |
| XLogP | 0.15 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|