C33H42O5 — CID 159124884
3-methylidene-8-(phenylmethoxymethoxy)bicyclo[3.2.1]octane;8-(phenylmethoxymethoxy)bicyclo[3.2.1]octan-3-one (PubChem CID 159124884) has the molecular formula C33H42O5 and a molecular weight of 518.69 g/mol. Its IUPAC name is 3-methylidene-8-(phenylmethoxymethoxy)bicyclo[3.2.1]octane;8-(phenylmethoxymethoxy)bicyclo[3.2.1]octan-3-one.
| Compound Name | 3-methylidene-8-(phenylmethoxymethoxy)bicyclo[3.2.1]octane;8-(phenylmethoxymethoxy)bicyclo[3.2.1]octan-3-one |
|---|---|
| PubChem CID | 159124884 |
| Molecular Formula | C33H42O5 |
| Molecular Weight | 518.69 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | 3-methylidene-8-(phenylmethoxymethoxy)bicyclo[3.2.1]octane;8-(phenylmethoxymethoxy)bicyclo[3.2.1]octan-3-one |
| SMILES | C=C1CC2CCC(C1)C2OCOCc1ccccc1.O=C1CC2CCC(C1)C2OCOCc1ccccc1 |
| InChI | InChI=1S/C17H22O2.C16H20O3/c1-13-9-15-7-8-16(10-13)17(15)19-12-18-11-14-5-3-2-4-6-14;17-15-8-13-6-7-14(9-15)16(13)19-11-18-10-12-4-2-1-3-5-12/h2-6,15-17H,1,7-12H2;1-5,13-14,16H,6-11H2 |
| InChIKey | KGDQMOJJZJGIPE-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.69 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|