About 2-fluoroacetic acid;iodobenzene;octadecanoic acid
2-fluoroacetic acid;iodobenzene;octadecanoic acid (PubChem CID 159130356) has the molecular formula C26H44FIO4
and a molecular weight of 566.54 g/mol. Its IUPAC name is 2-fluoroacetic acid;iodobenzene;octadecanoic acid.
Molecular Properties
| Compound Name | 2-fluoroacetic acid;iodobenzene;octadecanoic acid |
| PubChem CID | 159130356 |
| Molecular Formula | C26H44FIO4 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.23 |
| IUPAC Name | 2-fluoroacetic acid;iodobenzene;octadecanoic acid |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.Ic1ccccc1.O=C(O)CF |
| InChI | InChI=1S/C18H36O2.C6H5I.C2H3FO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-6-4-2-1-3-5-6;3-1-2(4)5/h2-17H2,1H3,(H,19,20);1-5H;1H2,(H,4,5) |
| InChIKey | KGUSJESRXWLYBL-UHFFFAOYSA-N |
| XLogP | 8.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 8.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoroacetic acid;iodobenzene;octadecanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoroacetic acid;iodobenzene;octadecanoic acid?
The IUPAC name of 2-fluoroacetic acid;iodobenzene;octadecanoic acid (CID 159130356) is 2-fluoroacetic acid;iodobenzene;octadecanoic acid.
What is the SMILES notation for 2-fluoroacetic acid;iodobenzene;octadecanoic acid?
The canonical SMILES for 2-fluoroacetic acid;iodobenzene;octadecanoic acid is CCCCCCCCCCCCCCCCCC(=O)O.Ic1ccccc1.O=C(O)CF.
What is the InChIKey of 2-fluoroacetic acid;iodobenzene;octadecanoic acid?
The InChIKey is KGUSJESRXWLYBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C6H5I.C2H3FO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-6-4-2-1-3-5-6;3-1-2(4)5/h2-17H2,1H3,(H,19,20);1-5H;1H2,(H,4,5).
What are the key properties of 2-fluoroacetic acid;iodobenzene;octadecanoic acid?
2-fluoroacetic acid;iodobenzene;octadecanoic acid has a molecular weight of 566.54 g/mol, XLogP of 8.66, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoroacetic acid;iodobenzene;octadecanoic acid is sourced from PubChem (CID 159130356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).