C22H23F3N4O2S2 — CID 159134202
4-[(3aS,7aS)-3-(6-acetyl-3-pyridinyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-2-(trifluoromethyl)benzonitrile;sulfane (PubChem CID 159134202) has the molecular formula C22H23F3N4O2S2 and a molecular weight of 496.58 g/mol. Its IUPAC name is 4-[(3aS,7aS)-3-(6-acetyl-3-pyridinyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-2-(trifluoromethyl)benzonitrile;sulfane.
| Compound Name | 4-[(3aS,7aS)-3-(6-acetyl-3-pyridinyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-2-(trifluoromethyl)benzonitrile;sulfane |
|---|---|
| PubChem CID | 159134202 |
| Molecular Formula | C22H23F3N4O2S2 |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | 4-[(3aS,7aS)-3-(6-acetyl-3-pyridinyl)-2-oxo-3a,4,5,6,7,7a-hexahydrobenzimidazol-1-yl]-2-(trifluoromethyl)benzonitrile;sulfane |
| SMILES | CC(=O)c1ccc(N2C(=O)N(c3ccc(C#N)c(C(F)(F)F)c3)[C@H]3CCCC[C@@H]32)cn1.S.S |
| InChI | InChI=1S/C22H19F3N4O2.2H2S/c1-13(30)18-9-8-16(12-27-18)29-20-5-3-2-4-19(20)28(21(29)31)15-7-6-14(11-26)17(10-15)22(23,24)25;;/h6-10,12,19-20H,2-5H2,1H3;2*1H2/t19-,20-;;/m0../s1 |
| InChIKey | KHGSMPMALLSQMT-TULUPMBKSA-N |
| XLogP | 5.16 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |