C17H13F3N6O — CID 130364625
(3S)-1-cyano-N-[1-[4-cyano-3-(trifluoromethyl)phenyl]imidazol-4-yl]pyrrolidine-3-carboxamide (PubChem CID 130364625) has the molecular formula C17H13F3N6O and a molecular weight of 374.33 g/mol. Its IUPAC name is (3S)-1-cyano-N-[1-[4-cyano-3-(trifluoromethyl)phenyl]imidazol-4-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyano-N-[1-[4-cyano-3-(trifluoromethyl)phenyl]imidazol-4-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 130364625 |
| Molecular Formula | C17H13F3N6O |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | (3S)-1-cyano-N-[1-[4-cyano-3-(trifluoromethyl)phenyl]imidazol-4-yl]pyrrolidine-3-carboxamide |
| SMILES | N#Cc1ccc(-n2cnc(NC(=O)[C@H]3CCN(C#N)C3)c2)cc1C(F)(F)F |
| InChI | InChI=1S/C17H13F3N6O/c18-17(19,20)14-5-13(2-1-11(14)6-21)26-8-15(23-10-26)24-16(27)12-3-4-25(7-12)9-22/h1-2,5,8,10,12H,3-4,7H2,(H,24,27)/t12-/m0/s1 |
| InChIKey | XZIUGCPTDKRVIN-LBPRGKRZSA-N |
| XLogP | 2.50 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|