C20H20N6O3 — CID 118980842
1-cyano-N-[1-[2-cyano-5-[(3S)-oxolan-3-yl]oxyphenyl]imidazol-4-yl]pyrrolidine-3-carboxamide (PubChem CID 118980842) has the molecular formula C20H20N6O3 and a molecular weight of 392.42 g/mol. Its IUPAC name is 1-cyano-N-[1-[2-cyano-5-[(3S)-oxolan-3-yl]oxyphenyl]imidazol-4-yl]pyrrolidine-3-carboxamide.
| Compound Name | 1-cyano-N-[1-[2-cyano-5-[(3S)-oxolan-3-yl]oxyphenyl]imidazol-4-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118980842 |
| Molecular Formula | C20H20N6O3 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 1-cyano-N-[1-[2-cyano-5-[(3S)-oxolan-3-yl]oxyphenyl]imidazol-4-yl]pyrrolidine-3-carboxamide |
| SMILES | N#Cc1ccc(O[C@H]2CCOC2)cc1-n1cnc(NC(=O)C2CCN(C#N)C2)c1 |
| InChI | InChI=1S/C20H20N6O3/c21-8-14-1-2-16(29-17-4-6-28-11-17)7-18(14)26-10-19(23-13-26)24-20(27)15-3-5-25(9-15)12-22/h1-2,7,10,13,15,17H,3-6,9,11H2,(H,24,27)/t15?,17-/m0/s1 |
| InChIKey | NWNRGNGLLCBLJJ-LWKPJOBUSA-N |
| XLogP | 1.65 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|