C16H15N7O — CID 118980679
(3S)-1-cyano-N-[1-(1H-indazol-6-yl)imidazol-4-yl]pyrrolidine-3-carboxamide (PubChem CID 118980679) has the molecular formula C16H15N7O and a molecular weight of 321.34 g/mol. Its IUPAC name is (3S)-1-cyano-N-[1-(1H-indazol-6-yl)imidazol-4-yl]pyrrolidine-3-carboxamide.
| Compound Name | (3S)-1-cyano-N-[1-(1H-indazol-6-yl)imidazol-4-yl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 118980679 |
| Molecular Formula | C16H15N7O |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | (3S)-1-cyano-N-[1-(1H-indazol-6-yl)imidazol-4-yl]pyrrolidine-3-carboxamide |
| SMILES | N#CN1CC[C@H](C(=O)Nc2cn(-c3ccc4cn[nH]c4c3)cn2)C1 |
| InChI | InChI=1S/C16H15N7O/c17-9-22-4-3-12(7-22)16(24)20-15-8-23(10-18-15)13-2-1-11-6-19-21-14(11)5-13/h1-2,5-6,8,10,12H,3-4,7H2,(H,19,21)(H,20,24)/t12-/m0/s1 |
| InChIKey | JIYXWYLKKGJVNC-LBPRGKRZSA-N |
| XLogP | 1.49 |
| TPSA | 102.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|