C16H24O2 — CID 159136545
4-ethenyl-5,5-dimethyl-2H-furan;3-methyl-3-prop-2-enoxybut-1-yne (PubChem CID 159136545) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 4-ethenyl-5,5-dimethyl-2H-furan;3-methyl-3-prop-2-enoxybut-1-yne.
| Compound Name | 4-ethenyl-5,5-dimethyl-2H-furan;3-methyl-3-prop-2-enoxybut-1-yne |
|---|---|
| PubChem CID | 159136545 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 4-ethenyl-5,5-dimethyl-2H-furan;3-methyl-3-prop-2-enoxybut-1-yne |
| SMILES | C#CC(C)(C)OCC=C.C=CC1=CCOC1(C)C |
| InChI | InChI=1S/2C8H12O/c1-4-7-5-6-9-8(7,2)3;1-5-7-9-8(3,4)6-2/h4-5H,1,6H2,2-3H3;2,5H,1,7H2,3-4H3 |
| InChIKey | KHOGHFGQCGQEQD-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|