C21H24N2O5S — CID 159137681
(3S)-N-hydroxy-4-[(3R)-oxolane-3-carbonyl]-3-phenyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide;sulfane (PubChem CID 159137681) has the molecular formula C21H24N2O5S and a molecular weight of 416.50 g/mol. Its IUPAC name is (3S)-N-hydroxy-4-[(3R)-oxolane-3-carbonyl]-3-phenyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide;sulfane.
| Compound Name | (3S)-N-hydroxy-4-[(3R)-oxolane-3-carbonyl]-3-phenyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide;sulfane |
|---|---|
| PubChem CID | 159137681 |
| Molecular Formula | C21H24N2O5S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.14 |
| IUPAC Name | (3S)-N-hydroxy-4-[(3R)-oxolane-3-carbonyl]-3-phenyl-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide;sulfane |
| SMILES | O=C(NO)c1ccc2c(c1)OC[C@H](c1ccccc1)N(C(=O)[C@@H]1CCOC1)C2.S |
| InChI | InChI=1S/C21H22N2O5.H2S/c24-20(22-26)15-6-7-16-11-23(21(25)17-8-9-27-12-17)18(13-28-19(16)10-15)14-4-2-1-3-5-14;/h1-7,10,17-18,26H,8-9,11-13H2,(H,22,24);1H2/t17-,18-;/m1./s1 |
| InChIKey | KHRYUPQFNNFDCY-JAXOOIEVSA-N |
| XLogP | 2.42 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|