C22H21N3O3 — CID 172798618
(3S)-N-hydroxy-3-phenyl-4-(pyridin-4-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide (PubChem CID 172798618) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is (3S)-N-hydroxy-3-phenyl-4-(pyridin-4-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide.
| Compound Name | (3S)-N-hydroxy-3-phenyl-4-(pyridin-4-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
|---|---|
| PubChem CID | 172798618 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | (3S)-N-hydroxy-3-phenyl-4-(pyridin-4-ylmethyl)-3,5-dihydro-2H-1,4-benzoxazepine-8-carboxamide |
| SMILES | O=C(NO)c1ccc2c(c1)OC[C@H](c1ccccc1)N(Cc1ccncc1)C2 |
| InChI | InChI=1S/C22H21N3O3/c26-22(24-27)18-6-7-19-14-25(13-16-8-10-23-11-9-16)20(15-28-21(19)12-18)17-4-2-1-3-5-17/h1-12,20,27H,13-15H2,(H,24,26)/t20-/m1/s1 |
| InChIKey | QNVLSWMLXOVUQV-HXUWFJFHSA-N |
| XLogP | 3.34 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|