C22H28N6O3S — CID 159138296
(7S)-2-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one;sulfane (PubChem CID 159138296) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is (7S)-2-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one;sulfane.
| Compound Name | (7S)-2-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one;sulfane |
|---|---|
| PubChem CID | 159138296 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (7S)-2-[[4-[(3,5-dimethyl-1,2-oxazol-4-yl)methoxy]phenyl]methylamino]-4,7,8-trimethyl-5,7-dihydropteridin-6-one;sulfane |
| SMILES | Cc1noc(C)c1COc1ccc(CNc2nc(C)c3c(n2)N(C)[C@@H](C)C(=O)N3)cc1.S |
| InChI | InChI=1S/C22H26N6O3.H2S/c1-12-18(15(4)31-27-12)11-30-17-8-6-16(7-9-17)10-23-22-24-13(2)19-20(26-22)28(5)14(3)21(29)25-19;/h6-9,14H,10-11H2,1-5H3,(H,25,29)(H,23,24,26);1H2/t14-;/m0./s1 |
| InChIKey | KHTVSFJQPWWYMY-UQKRIMTDSA-N |
| XLogP | 3.47 |
| TPSA | 105.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |