C18H23N5O3 — CID 159140970
ethyl 4-(methylamino)-2-[(6-morpholin-4-yl-3-pyridinyl)methyl]pyrimidine-5-carboxylate (PubChem CID 159140970) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is ethyl 4-(methylamino)-2-[(6-morpholin-4-yl-3-pyridinyl)methyl]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(methylamino)-2-[(6-morpholin-4-yl-3-pyridinyl)methyl]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 159140970 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | ethyl 4-(methylamino)-2-[(6-morpholin-4-yl-3-pyridinyl)methyl]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(Cc2ccc(N3CCOCC3)nc2)nc1NC |
| InChI | InChI=1S/C18H23N5O3/c1-3-26-18(24)14-12-20-15(22-17(14)19-2)10-13-4-5-16(21-11-13)23-6-8-25-9-7-23/h4-5,11-12H,3,6-10H2,1-2H3,(H,19,20,22) |
| InChIKey | PBTQWYXHJGWUAQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 89.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |