C9H13N3O4 — CID 15914241
methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate (PubChem CID 15914241) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate.
| Compound Name | methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate |
|---|---|
| PubChem CID | 15914241 |
| Molecular Formula | C9H13N3O4 |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.09 |
| IUPAC Name | methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate |
| SMILES | COC(=O)c1nccnc1NCC(O)CO |
| InChI | InChI=1S/C9H13N3O4/c1-16-9(15)7-8(11-3-2-10-7)12-4-6(14)5-13/h2-3,6,13-14H,4-5H2,1H3,(H,11,12) |
| InChIKey | KDSJSEAHWNLKPD-UHFFFAOYSA-N |
| XLogP | -0.97 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | -0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |