methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate

C9H13N3O4 — CID 15914241

IUPACmethyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate
SMILESCOC(=O)c1nccnc1NCC(O)CO
InChIInChI=1S/C9H13N3O4/c1-16-9(15)7-8(11-3-2-10-7)12-4-6(14)5-13/h2-3,6,13-14H,4-5H2,1H3,(H,11,12)
InChIKeyKDSJSEAHWNLKPD-UHFFFAOYSA-N
MW227.22 g/mol
LogP-0.97
Rot. Bonds5

About methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate

methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate (PubChem CID 15914241) has the molecular formula C9H13N3O4 and a molecular weight of 227.22 g/mol. Its IUPAC name is methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate.

Molecular Properties

Compound Namemethyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate
PubChem CID15914241
Molecular FormulaC9H13N3O4
Molecular Weight227.22 g/mol
Exact Mass227.09
IUPAC Namemethyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate
SMILESCOC(=O)c1nccnc1NCC(O)CO
InChIInChI=1S/C9H13N3O4/c1-16-9(15)7-8(11-3-2-10-7)12-4-6(14)5-13/h2-3,6,13-14H,4-5H2,1H3,(H,11,12)
InChIKeyKDSJSEAHWNLKPD-UHFFFAOYSA-N
XLogP-0.97
TPSA104.57 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500227.22
LogP ≤ 5-0.97
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Analyze methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate?
The IUPAC name of methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate (CID 15914241) is methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate.
What is the SMILES notation for methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate?
The canonical SMILES for methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate is COC(=O)c1nccnc1NCC(O)CO.
What is the InChIKey of methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate?
The InChIKey is KDSJSEAHWNLKPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N3O4/c1-16-9(15)7-8(11-3-2-10-7)12-4-6(14)5-13/h2-3,6,13-14H,4-5H2,1H3,(H,11,12).
What are the key properties of methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate?
methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate has a molecular weight of 227.22 g/mol, XLogP of -0.97, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2,3-dihydroxypropylamino)pyrazine-2-carboxylate is sourced from PubChem (CID 15914241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).