C42H39BN2Si — CID 159144138
8-(1-Adamantyl)-11,22-dimethyl-14,22-diphenyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene (PubChem CID 159144138) has the molecular formula C42H39BN2Si and a molecular weight of 610.70 g/mol. Its IUPAC name is 8-(1-adamantyl)-11,22-dimethyl-14,22-diphenyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene.
| Compound Name | 8-(1-Adamantyl)-11,22-dimethyl-14,22-diphenyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
|---|---|
| PubChem CID | 159144138 |
| Molecular Formula | C42H39BN2Si |
| Molecular Weight | 610.70 g/mol |
| Exact Mass | 610.30 |
| IUPAC Name | 8-(1-adamantyl)-11,22-dimethyl-14,22-diphenyl-8,14-diaza-22-sila-1-borahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9,11,13(21),15(20),16,18-nonaene |
| SMILES | B12C3=C4C=CC=C3[Si](C5=CC=CC(=C51)N(C6=CC(=CC(=C26)N4C7=CC=CC=C7)C)C89CC1CC(C8)CC(C1)C9)(C)C1=CC=CC=C1 |
| InChI | InChI=1S/C42H39BN2Si/c1-27-19-35-39-36(20-27)45(42-24-28-21-29(25-42)23-30(22-28)26-42)34-16-10-18-38-41(34)43(39)40-33(44(35)31-11-5-3-6-12-31)15-9-17-37(40)46(38,2)32-13-7-4-8-14-32/h3-20,28-30H,21-26H2,1-2H3 |
| InChIKey | SROGSFTUJPEDKT-UHFFFAOYSA-N |
| XLogP | — |
| TPSA | 6.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | 1140 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|