C36H32N14O6 — CID 159147051
6,7-dimethoxy-4-[1-[(3-nitrophenyl)methyl]tetrazol-5-yl]quinazoline;3-[[5-(6,7-dimethoxyquinazolin-4-yl)tetrazol-1-yl]methyl]aniline (PubChem CID 159147051) has the molecular formula C36H32N14O6 and a molecular weight of 756.74 g/mol. Its IUPAC name is 6,7-dimethoxy-4-[1-[(3-nitrophenyl)methyl]tetrazol-5-yl]quinazoline;3-[[5-(6,7-dimethoxyquinazolin-4-yl)tetrazol-1-yl]methyl]aniline.
| Compound Name | 6,7-dimethoxy-4-[1-[(3-nitrophenyl)methyl]tetrazol-5-yl]quinazoline;3-[[5-(6,7-dimethoxyquinazolin-4-yl)tetrazol-1-yl]methyl]aniline |
|---|---|
| PubChem CID | 159147051 |
| Molecular Formula | C36H32N14O6 |
| Molecular Weight | 756.74 g/mol |
| Exact Mass | 756.26 |
| IUPAC Name | 6,7-dimethoxy-4-[1-[(3-nitrophenyl)methyl]tetrazol-5-yl]quinazoline;3-[[5-(6,7-dimethoxyquinazolin-4-yl)tetrazol-1-yl]methyl]aniline |
| SMILES | COc1cc2ncnc(-c3nnnn3Cc3cccc(N)c3)c2cc1OC.COc1cc2ncnc(-c3nnnn3Cc3cccc([N+](=O)[O-])c3)c2cc1OC |
| InChI | InChI=1S/C18H15N7O4.C18H17N7O2/c1-28-15-7-13-14(8-16(15)29-2)19-10-20-17(13)18-21-22-23-24(18)9-11-4-3-5-12(6-11)25(26)27;1-26-15-7-13-14(8-16(15)27-2)20-10-21-17(13)18-22-23-24-25(18)9-11-4-3-5-12(19)6-11/h3-8,10H,9H2,1-2H3;3-8,10H,9,19H2,1-2H3 |
| InChIKey | KIUUYWJPVBKQKA-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 244.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.74 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|