C21H22FN9O14S2 — CID 159148535
N-[6-(1,3-dihydroxypropan-2-ylamino)-7-nitro-2,4-dioxo-1H-quinazolin-3-yl]methanesulfonamide;N-(6-fluoro-7-nitro-2,4-dioxo-1H-quinazolin-3-yl)methanesulfonamide (PubChem CID 159148535) has the molecular formula C21H22FN9O14S2 and a molecular weight of 707.59 g/mol. Its IUPAC name is N-[6-(1,3-dihydroxypropan-2-ylamino)-7-nitro-2,4-dioxo-1H-quinazolin-3-yl]methanesulfonamide;N-(6-fluoro-7-nitro-2,4-dioxo-1H-quinazolin-3-yl)methanesulfonamide.
| Compound Name | N-[6-(1,3-dihydroxypropan-2-ylamino)-7-nitro-2,4-dioxo-1H-quinazolin-3-yl]methanesulfonamide;N-(6-fluoro-7-nitro-2,4-dioxo-1H-quinazolin-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 159148535 |
| Molecular Formula | C21H22FN9O14S2 |
| Molecular Weight | 707.59 g/mol |
| Exact Mass | 707.07 |
| IUPAC Name | N-[6-(1,3-dihydroxypropan-2-ylamino)-7-nitro-2,4-dioxo-1H-quinazolin-3-yl]methanesulfonamide;N-(6-fluoro-7-nitro-2,4-dioxo-1H-quinazolin-3-yl)methanesulfonamide |
| SMILES | CS(=O)(=O)Nn1c(=O)[nH]c2cc([N+](=O)[O-])c(F)cc2c1=O.CS(=O)(=O)Nn1c(=O)[nH]c2cc([N+](=O)[O-])c(NC(CO)CO)cc2c1=O |
| InChI | InChI=1S/C12H15N5O8S.C9H7FN4O6S/c1-26(24,25)15-16-11(20)7-2-9(13-6(4-18)5-19)10(17(22)23)3-8(7)14-12(16)21;1-21(19,20)12-13-8(15)4-2-5(10)7(14(17)18)3-6(4)11-9(13)16/h2-3,6,13,15,18-19H,4-5H2,1H3,(H,14,21);2-3,12H,1H3,(H,11,16) |
| InChIKey | KIZGJNZHHQEGRT-UHFFFAOYSA-N |
| XLogP | -2.89 |
| TPSA | 340.83 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.59 |
| LogP ≤ 5 | -2.89 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|