C16H34N4O4 — CID 159148624
(5S,6R)-6-(7-methoxy-1,4,7,10-tetrazacyclododec-1-yl)-2,2-dimethyl-1,3-dioxepan-5-ol (PubChem CID 159148624) has the molecular formula C16H34N4O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is (5S,6R)-6-(7-methoxy-1,4,7,10-tetrazacyclododec-1-yl)-2,2-dimethyl-1,3-dioxepan-5-ol.
| Compound Name | (5S,6R)-6-(7-methoxy-1,4,7,10-tetrazacyclododec-1-yl)-2,2-dimethyl-1,3-dioxepan-5-ol |
|---|---|
| PubChem CID | 159148624 |
| Molecular Formula | C16H34N4O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.26 |
| IUPAC Name | (5S,6R)-6-(7-methoxy-1,4,7,10-tetrazacyclododec-1-yl)-2,2-dimethyl-1,3-dioxepan-5-ol |
| SMILES | CON1CCNCCN([C@@H]2COC(C)(C)OC[C@H]2O)CCNCC1 |
| InChI | InChI=1S/C16H34N4O4/c1-16(2)23-12-14(15(21)13-24-16)19-8-4-17-6-10-20(22-3)11-7-18-5-9-19/h14-15,17-18,21H,4-13H2,1-3H3/t14-,15-/m1/s1 |
| InChIKey | LHLWKBOEIZNRHZ-HUUCEWRRSA-N |
| XLogP | -1.14 |
| TPSA | 78.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |