C29H35N5O8S2 — CID 159149295
2-[2-[[[2-[6-[(4S,7R)-7-acetamido-4-methyl-6,9-dioxodecanoyl]-5-oxo-4-azaspiro[2.4]hept-6-en-7-yl]acetyl]amino]methyl]-1,3-thiazol-4-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid (PubChem CID 159149295) has the molecular formula C29H35N5O8S2 and a molecular weight of 645.76 g/mol. Its IUPAC name is 2-[2-[[[2-[6-[(4S,7R)-7-acetamido-4-methyl-6,9-dioxodecanoyl]-5-oxo-4-azaspiro[2.4]hept-6-en-7-yl]acetyl]amino]methyl]-1,3-thiazol-4-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[2-[[[2-[6-[(4S,7R)-7-acetamido-4-methyl-6,9-dioxodecanoyl]-5-oxo-4-azaspiro[2.4]hept-6-en-7-yl]acetyl]amino]methyl]-1,3-thiazol-4-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 159149295 |
| Molecular Formula | C29H35N5O8S2 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.19 |
| IUPAC Name | 2-[2-[[[2-[6-[(4S,7R)-7-acetamido-4-methyl-6,9-dioxodecanoyl]-5-oxo-4-azaspiro[2.4]hept-6-en-7-yl]acetyl]amino]methyl]-1,3-thiazol-4-yl]-4,5-dihydro-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(=O)C[C@@H](NC(C)=O)C(=O)C[C@@H](C)CCC(=O)C1=C(CC(=O)NCc2nc(C3=NC(C(=O)O)CS3)cs2)C2(CC2)NC1=O |
| InChI | InChI=1S/C29H35N5O8S2/c1-14(8-22(38)18(9-15(2)35)31-16(3)36)4-5-21(37)25-17(29(6-7-29)34-26(25)40)10-23(39)30-11-24-32-19(12-43-24)27-33-20(13-44-27)28(41)42/h12,14,18,20H,4-11,13H2,1-3H3,(H,30,39)(H,31,36)(H,34,40)(H,41,42)/t14-,18+,20?/m0/s1 |
| InChIKey | DYXBGYXXADTNKK-FCCRLDTDSA-N |
| XLogP | 1.48 |
| TPSA | 201.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|