C32H46N4O4S3 — CID 90804136
S-[4-(5-methyl-6,9,15-trioxo-8-propan-2-yl-3,19-dithia-7,16,21,22-tetrazatetracyclo[16.2.1.12,5.010,12]docosa-1(20),2(22),18(21)-trien-13-yl)but-3-enyl] octanethioate (PubChem CID 90804136) has the molecular formula C32H46N4O4S3 and a molecular weight of 646.95 g/mol. Its IUPAC name is S-[4-(5-methyl-6,9,15-trioxo-8-propan-2-yl-3,19-dithia-7,16,21,22-tetrazatetracyclo[16.2.1.12,5.010,12]docosa-1(20),2(22),18(21)-trien-13-yl)but-3-enyl] octanethioate.
| Compound Name | S-[4-(5-methyl-6,9,15-trioxo-8-propan-2-yl-3,19-dithia-7,16,21,22-tetrazatetracyclo[16.2.1.12,5.010,12]docosa-1(20),2(22),18(21)-trien-13-yl)but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 90804136 |
| Molecular Formula | C32H46N4O4S3 |
| Molecular Weight | 646.95 g/mol |
| Exact Mass | 646.27 |
| IUPAC Name | S-[4-(5-methyl-6,9,15-trioxo-8-propan-2-yl-3,19-dithia-7,16,21,22-tetrazatetracyclo[16.2.1.12,5.010,12]docosa-1(20),2(22),18(21)-trien-13-yl)but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCCC=CC1CC(=O)NCc2nc(cs2)C2=NC(C)(CS2)C(=O)NC(C(C)C)C(=O)C2CC12 |
| InChI | InChI=1S/C32H46N4O4S3/c1-5-6-7-8-9-13-27(38)41-14-11-10-12-21-15-25(37)33-17-26-34-24(18-42-26)30-36-32(4,19-43-30)31(40)35-28(20(2)3)29(39)23-16-22(21)23/h10,12,18,20-23,28H,5-9,11,13-17,19H2,1-4H3,(H,33,37)(H,35,40) |
| InChIKey | YAXHNXYBGHUDDL-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.95 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|