C22H28N4O3S3 — CID 59179853
(5R,11S)-5-methyl-14-[(E)-4-sulfanylbut-1-enyl]-3,20-dithia-7,17,22,23-tetrazatetracyclo[17.2.1.12,5.07,11]tricosa-1(21),2(23),19(22)-triene-6,12,16-trione (PubChem CID 59179853) has the molecular formula C22H28N4O3S3 and a molecular weight of 492.69 g/mol. Its IUPAC name is (5R,11S)-5-methyl-14-[(E)-4-sulfanylbut-1-enyl]-3,20-dithia-7,17,22,23-tetrazatetracyclo[17.2.1.12,5.07,11]tricosa-1(21),2(23),19(22)-triene-6,12,16-trione.
| Compound Name | (5R,11S)-5-methyl-14-[(E)-4-sulfanylbut-1-enyl]-3,20-dithia-7,17,22,23-tetrazatetracyclo[17.2.1.12,5.07,11]tricosa-1(21),2(23),19(22)-triene-6,12,16-trione |
|---|---|
| PubChem CID | 59179853 |
| Molecular Formula | C22H28N4O3S3 |
| Molecular Weight | 492.69 g/mol |
| Exact Mass | 492.13 |
| IUPAC Name | (5R,11S)-5-methyl-14-[(E)-4-sulfanylbut-1-enyl]-3,20-dithia-7,17,22,23-tetrazatetracyclo[17.2.1.12,5.07,11]tricosa-1(21),2(23),19(22)-triene-6,12,16-trione |
| SMILES | C[C@@]12CSC(=N1)c1csc(n1)CNC(=O)CC(/C=C/CCS)CC(=O)[C@@H]1CCCN1C2=O |
| InChI | InChI=1S/C22H28N4O3S3/c1-22-13-32-20(25-22)15-12-31-19(24-15)11-23-18(28)10-14(5-2-3-8-30)9-17(27)16-6-4-7-26(16)21(22)29/h2,5,12,14,16,30H,3-4,6-11,13H2,1H3,(H,23,28)/b5-2+/t14?,16-,22-/m0/s1 |
| InChIKey | HQSDZXXRPLLQON-WVZIWKIWSA-N |
| XLogP | 2.86 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.69 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|