C29H43N5O4S3 — CID 90706011
S-[4-[(5R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate (PubChem CID 90706011) has the molecular formula C29H43N5O4S3 and a molecular weight of 621.90 g/mol. Its IUPAC name is S-[4-[(5R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate.
| Compound Name | S-[4-[(5R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 90706011 |
| Molecular Formula | C29H43N5O4S3 |
| Molecular Weight | 621.90 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | S-[4-[(5R)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCCC=CC1CC(=O)NCc2nc(cs2)C2=N[C@@](C)(CS2)C(=O)NC(C(C)C)C(=O)N1 |
| InChI | InChI=1S/C29H43N5O4S3/c1-5-6-7-8-9-13-24(36)39-14-11-10-12-20-15-22(35)30-16-23-32-21(17-40-23)27-34-29(4,18-41-27)28(38)33-25(19(2)3)26(37)31-20/h10,12,17,19-20,25H,5-9,11,13-16,18H2,1-4H3,(H,30,35)(H,31,37)(H,33,38)/t20?,25?,29-/m0/s1 |
| InChIKey | FZBLZWMNFPJGGN-UAOHEDPGSA-N |
| XLogP | 4.61 |
| TPSA | 129.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.90 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|