C30H44N4O4S3 — CID 59179816
S-[(E)-4-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate (PubChem CID 59179816) has the molecular formula C30H44N4O4S3 and a molecular weight of 620.91 g/mol. Its IUPAC name is S-[(E)-4-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate.
| Compound Name | S-[(E)-4-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate |
|---|---|
| PubChem CID | 59179816 |
| Molecular Formula | C30H44N4O4S3 |
| Molecular Weight | 620.91 g/mol |
| Exact Mass | 620.25 |
| IUPAC Name | S-[(E)-4-[(5R,8S,11S)-5-methyl-6,9,13-trioxo-8-propan-2-yl-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-trien-11-yl]but-3-enyl] octanethioate |
| SMILES | CCCCCCCC(=O)SCC/C=C/[C@@H]1CC(=O)NCc2nc(cs2)C2=N[C@@](C)(CS2)C(=O)N[C@@H](C(C)C)C(=O)C1 |
| InChI | InChI=1S/C30H44N4O4S3/c1-5-6-7-8-9-13-26(37)39-14-11-10-12-21-15-23(35)27(20(2)3)33-29(38)30(4)19-41-28(34-30)22-18-40-25(32-22)17-31-24(36)16-21/h10,12,18,20-21,27H,5-9,11,13-17,19H2,1-4H3,(H,31,36)(H,33,38)/b12-10+/t21-,27-,30-/m0/s1 |
| InChIKey | XQZZYUMCMGEGFG-KSTGWBNZSA-N |
| XLogP | 5.70 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.91 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|