C22H30N4O3S3 — CID 59179818
(5R,8S)-5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione (PubChem CID 59179818) has the molecular formula C22H30N4O3S3 and a molecular weight of 494.71 g/mol. Its IUPAC name is (5R,8S)-5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione.
| Compound Name | (5R,8S)-5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
|---|---|
| PubChem CID | 59179818 |
| Molecular Formula | C22H30N4O3S3 |
| Molecular Weight | 494.71 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | (5R,8S)-5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3,17-dithia-7,14,19,20-tetrazatricyclo[14.2.1.12,5]icosa-1(18),2(20),16(19)-triene-6,9,13-trione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@]2(C)CSC(=N2)c2csc(n2)CNC(=O)CC(/C=C/CCS)CC1=O |
| InChI | InChI=1S/C22H30N4O3S3/c1-13(2)19-16(27)8-14(6-4-5-7-30)9-17(28)23-10-18-24-15(11-31-18)20-26-22(3,12-32-20)21(29)25-19/h4,6,11,13-14,19,30H,5,7-10,12H2,1-3H3,(H,23,28)(H,25,29)/b6-4+/t14?,19-,22-/m0/s1 |
| InChIKey | SWMHHJWUSRNXIQ-SLDPDMDXSA-N |
| XLogP | 3.01 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.71 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|