C21H31N5O3S3 — CID 91667418
(5R,8S,11S)-5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),16(19)-diene-6,9,13-trione (PubChem CID 91667418) has the molecular formula C21H31N5O3S3 and a molecular weight of 497.71 g/mol. Its IUPAC name is (5R,8S,11S)-5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),16(19)-diene-6,9,13-trione.
| Compound Name | (5R,8S,11S)-5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),16(19)-diene-6,9,13-trione |
|---|---|
| PubChem CID | 91667418 |
| Molecular Formula | C21H31N5O3S3 |
| Molecular Weight | 497.71 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | (5R,8S,11S)-5-methyl-8-propan-2-yl-11-[(E)-4-sulfanylbut-1-enyl]-3,17-dithia-7,10,14,19,20-pentazatricyclo[14.2.1.12,5]icosa-1(18),16(19)-diene-6,9,13-trione |
| SMILES | CC(C)[C@@H]1NC(=O)[C@]2(C)CSC(N2)c2csc(n2)CNC(=O)C[C@@H](/C=C/CCS)NC1=O |
| InChI | InChI=1S/C21H31N5O3S3/c1-12(2)17-18(28)23-13(6-4-5-7-30)8-15(27)22-9-16-24-14(10-31-16)19-26-21(3,11-32-19)20(29)25-17/h4,6,10,12-13,17,19,26,30H,5,7-9,11H2,1-3H3,(H,22,27)(H,23,28)(H,25,29)/b6-4+/t13-,17+,19?,21+/m1/s1 |
| InChIKey | DNWKEOZMSFUKHG-IFKBFPCXSA-N |
| XLogP | 1.76 |
| TPSA | 112.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.71 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|