About sodium;2-(azidomethyl)-6-bromopyridine;azide
sodium;2-(azidomethyl)-6-bromopyridine;azide (PubChem CID 159150392) has the molecular formula C6H5BrN7Na
and a molecular weight of 278.05 g/mol. Its IUPAC name is sodium;2-(azidomethyl)-6-bromopyridine;azide.
Molecular Properties
| Compound Name | sodium;2-(azidomethyl)-6-bromopyridine;azide |
| PubChem CID | 159150392 |
| Molecular Formula | C6H5BrN7Na |
| Molecular Weight | 278.05 g/mol |
| Exact Mass | 276.97 |
| IUPAC Name | sodium;2-(azidomethyl)-6-bromopyridine;azide |
| SMILES | [N-]=[N+]=NCc1cccc(Br)n1.[N-]=[N+]=[N-].[Na+] |
| InChI | InChI=1S/C6H5BrN4.N3.Na/c7-6-3-1-2-5(10-6)4-9-11-8;1-3-2;/h1-3H,4H2;;/q;-1;+1 |
| InChIKey | KJEZNNXIOLKWNA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 120.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.05 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze sodium;2-(azidomethyl)-6-bromopyridine;azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;2-(azidomethyl)-6-bromopyridine;azide?
The IUPAC name of sodium;2-(azidomethyl)-6-bromopyridine;azide (CID 159150392) is sodium;2-(azidomethyl)-6-bromopyridine;azide.
What is the SMILES notation for sodium;2-(azidomethyl)-6-bromopyridine;azide?
The canonical SMILES for sodium;2-(azidomethyl)-6-bromopyridine;azide is [N-]=[N+]=NCc1cccc(Br)n1.[N-]=[N+]=[N-].[Na+].
What is the InChIKey of sodium;2-(azidomethyl)-6-bromopyridine;azide?
The InChIKey is KJEZNNXIOLKWNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN4.N3.Na/c7-6-3-1-2-5(10-6)4-9-11-8;1-3-2;/h1-3H,4H2;;/q;-1;+1.
What are the key properties of sodium;2-(azidomethyl)-6-bromopyridine;azide?
sodium;2-(azidomethyl)-6-bromopyridine;azide has a molecular weight of 278.05 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;2-(azidomethyl)-6-bromopyridine;azide is sourced from PubChem (CID 159150392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).