C18H29BrCl2N2O3 — CID 159152208
2-(3-bromo-4-methoxyphenyl)-3-ethyl-1-piperazin-1-ylpentan-3-ol;chloro hypochlorite (PubChem CID 159152208) has the molecular formula C18H29BrCl2N2O3 and a molecular weight of 472.25 g/mol. Its IUPAC name is 2-(3-bromo-4-methoxyphenyl)-3-ethyl-1-piperazin-1-ylpentan-3-ol;chloro hypochlorite.
| Compound Name | 2-(3-bromo-4-methoxyphenyl)-3-ethyl-1-piperazin-1-ylpentan-3-ol;chloro hypochlorite |
|---|---|
| PubChem CID | 159152208 |
| Molecular Formula | C18H29BrCl2N2O3 |
| Molecular Weight | 472.25 g/mol |
| Exact Mass | 470.07 |
| IUPAC Name | 2-(3-bromo-4-methoxyphenyl)-3-ethyl-1-piperazin-1-ylpentan-3-ol;chloro hypochlorite |
| SMILES | CCC(O)(CC)C(CN1CCNCC1)c1ccc(OC)c(Br)c1.ClOCl |
| InChI | InChI=1S/C18H29BrN2O2.Cl2O/c1-4-18(22,5-2)15(13-21-10-8-20-9-11-21)14-6-7-17(23-3)16(19)12-14;1-3-2/h6-7,12,15,20,22H,4-5,8-11,13H2,1-3H3; |
| InChIKey | KJLCOAPNSUPCPF-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.25 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |