C23H23N3O3S — CID 159153884
5-[2-[[3-(ethylsulfonylmethyl)phenyl]methyl]pyrimidin-4-yl]oxy-2-methyl-1H-indole (PubChem CID 159153884) has the molecular formula C23H23N3O3S and a molecular weight of 421.52 g/mol. Its IUPAC name is 5-[2-[[3-(ethylsulfonylmethyl)phenyl]methyl]pyrimidin-4-yl]oxy-2-methyl-1H-indole.
| Compound Name | 5-[2-[[3-(ethylsulfonylmethyl)phenyl]methyl]pyrimidin-4-yl]oxy-2-methyl-1H-indole |
|---|---|
| PubChem CID | 159153884 |
| Molecular Formula | C23H23N3O3S |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | 5-[2-[[3-(ethylsulfonylmethyl)phenyl]methyl]pyrimidin-4-yl]oxy-2-methyl-1H-indole |
| SMILES | CCS(=O)(=O)Cc1cccc(Cc2nccc(Oc3ccc4[nH]c(C)cc4c3)n2)c1 |
| InChI | InChI=1S/C23H23N3O3S/c1-3-30(27,28)15-18-6-4-5-17(12-18)13-22-24-10-9-23(26-22)29-20-7-8-21-19(14-20)11-16(2)25-21/h4-12,14,25H,3,13,15H2,1-2H3 |
| InChIKey | KJQKPHIGCQRAET-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |