C21H24FN5O2 — CID 23646057
5-[(E)-cyclohexylmethoxyiminomethyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine (PubChem CID 23646057) has the molecular formula C21H24FN5O2 and a molecular weight of 397.45 g/mol. Its IUPAC name is 5-[(E)-cyclohexylmethoxyiminomethyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine.
| Compound Name | 5-[(E)-cyclohexylmethoxyiminomethyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 23646057 |
| Molecular Formula | C21H24FN5O2 |
| Molecular Weight | 397.45 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 5-[(E)-cyclohexylmethoxyiminomethyl]-6-[(4-fluoro-2-methyl-1H-indol-5-yl)oxy]pyrimidin-4-amine |
| SMILES | Cc1cc2c(F)c(Oc3ncnc(N)c3/C=N/OCC3CCCCC3)ccc2[nH]1 |
| InChI | InChI=1S/C21H24FN5O2/c1-13-9-15-17(27-13)7-8-18(19(15)22)29-21-16(20(23)24-12-25-21)10-26-28-11-14-5-3-2-4-6-14/h7-10,12,14,27H,2-6,11H2,1H3,(H2,23,24,25)/b26-10+ |
| InChIKey | HCPZISVZYWKEQP-NSKAYECMSA-N |
| XLogP | 4.71 |
| TPSA | 98.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|