About carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane
carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane (PubChem CID 159154967) has the molecular formula C13H26N2O3+2
and a molecular weight of 258.36 g/mol. Its IUPAC name is carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane.
Molecular Properties
| Compound Name | carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane |
| PubChem CID | 159154967 |
| Molecular Formula | C13H26N2O3+2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane |
| SMILES | C.COCCN(CCO)Cc1cc[n+](O)cc1.[CH3+] |
| InChI | InChI=1S/C11H19N2O3.CH4.CH3/c1-16-9-7-12(6-8-14)10-11-2-4-13(15)5-3-11;;/h2-5,14-15H,6-10H2,1H3;1H4;1H3/q+1;;+1 |
| InChIKey | PVUFVZCMZVKHML-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 56.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane?
The IUPAC name of carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane (CID 159154967) is carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane.
What is the SMILES notation for carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane?
The canonical SMILES for carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane is C.COCCN(CCO)Cc1cc[n+](O)cc1.[CH3+].
What is the InChIKey of carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane?
The InChIKey is PVUFVZCMZVKHML-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19N2O3.CH4.CH3/c1-16-9-7-12(6-8-14)10-11-2-4-13(15)5-3-11;;/h2-5,14-15H,6-10H2,1H3;1H4;1H3/q+1;;+1.
What are the key properties of carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane?
carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane has a molecular weight of 258.36 g/mol, XLogP of 0.74, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for carbanylium;2-[(1-hydroxypyridin-1-ium-4-yl)methyl-(2-methoxyethyl)amino]ethanol;methane is sourced from PubChem (CID 159154967), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).