C10H25N3O3S — CID 159156938
1-ethyl-3-propan-2-ylurea;N-propan-2-ylmethanesulfonamide (PubChem CID 159156938) has the molecular formula C10H25N3O3S and a molecular weight of 267.39 g/mol. Its IUPAC name is 1-ethyl-3-propan-2-ylurea;N-propan-2-ylmethanesulfonamide.
| Compound Name | 1-ethyl-3-propan-2-ylurea;N-propan-2-ylmethanesulfonamide |
|---|---|
| PubChem CID | 159156938 |
| Molecular Formula | C10H25N3O3S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | 1-ethyl-3-propan-2-ylurea;N-propan-2-ylmethanesulfonamide |
| SMILES | CC(C)NS(C)(=O)=O.CCNC(=O)NC(C)C |
| InChI | InChI=1S/C6H14N2O.C4H11NO2S/c1-4-7-6(9)8-5(2)3;1-4(2)5-8(3,6)7/h5H,4H2,1-3H3,(H2,7,8,9);4-5H,1-3H3 |
| InChIKey | KJZWMZHNVCCONF-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |