About iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine)
iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine) (PubChem CID 159158115) has the molecular formula C36H32IrN4
and a molecular weight of 712.90 g/mol. Its IUPAC name is iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine).
Molecular Properties
| Compound Name | iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine) |
| PubChem CID | 159158115 |
| Molecular Formula | C36H32IrN4 |
| Molecular Weight | 712.90 g/mol |
| Exact Mass | 713.23 |
| IUPAC Name | iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine) |
| SMILES | Cc1ccccc1-c1ncnc(-c2ccccc2)c1C.Cc1ccccc1-c1ncnc(-c2ccccc2)c1C.[Ir] |
| InChI | InChI=1S/2C18H16N2.Ir/c2*1-13-8-6-7-11-16(13)18-14(2)17(19-12-20-18)15-9-4-3-5-10-15;/h2*3-12H,1-2H3; |
| InChIKey | KKDKYEBNDLHEMY-UHFFFAOYSA-N |
| XLogP | 8.85 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 712.90 |
| LogP ≤ 5 | 8.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine)?
The IUPAC name of iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine) (CID 159158115) is iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine).
What is the SMILES notation for iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine)?
The canonical SMILES for iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine) is Cc1ccccc1-c1ncnc(-c2ccccc2)c1C.Cc1ccccc1-c1ncnc(-c2ccccc2)c1C.[Ir].
What is the InChIKey of iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine)?
The InChIKey is KKDKYEBNDLHEMY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C18H16N2.Ir/c2*1-13-8-6-7-11-16(13)18-14(2)17(19-12-20-18)15-9-4-3-5-10-15;/h2*3-12H,1-2H3;.
What are the key properties of iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine)?
iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine) has a molecular weight of 712.90 g/mol, XLogP of 8.85, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;bis(5-methyl-4-(2-methylphenyl)-6-phenylpyrimidine) is sourced from PubChem (CID 159158115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).