C36H44BrNO9 — CID 159161035
methyl (2S,3S)-2-acetyloxy-3-bromo-3-(4-methylphenyl)propanoate;methyl (2R,3S)-3-amino-2-methoxy-3-(4-methylphenyl)propanoate;methyl (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 159161035) has the molecular formula C36H44BrNO9 and a molecular weight of 714.65 g/mol. Its IUPAC name is methyl (2S,3S)-2-acetyloxy-3-bromo-3-(4-methylphenyl)propanoate;methyl (2R,3S)-3-amino-2-methoxy-3-(4-methylphenyl)propanoate;methyl (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | methyl (2S,3S)-2-acetyloxy-3-bromo-3-(4-methylphenyl)propanoate;methyl (2R,3S)-3-amino-2-methoxy-3-(4-methylphenyl)propanoate;methyl (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 159161035 |
| Molecular Formula | C36H44BrNO9 |
| Molecular Weight | 714.65 g/mol |
| Exact Mass | 713.22 |
| IUPAC Name | methyl (2S,3S)-2-acetyloxy-3-bromo-3-(4-methylphenyl)propanoate;methyl (2R,3S)-3-amino-2-methoxy-3-(4-methylphenyl)propanoate;methyl (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(C)cc1.COC(=O)[C@H](OC(C)=O)[C@@H](Br)c1ccc(C)cc1.COC(=O)[C@H](OC)[C@@H](N)c1ccc(C)cc1 |
| InChI | InChI=1S/C13H15BrO4.C12H17NO3.C11H12O2/c1-8-4-6-10(7-5-8)11(14)12(13(16)17-3)18-9(2)15;1-8-4-6-9(7-5-8)10(13)11(15-2)12(14)16-3;1-9-3-5-10(6-4-9)7-8-11(12)13-2/h4-7,11-12H,1-3H3;4-7,10-11H,13H2,1-3H3;3-8H,1-2H3/b;;8-7+/t11-,12+;10-,11+;/m00./s1 |
| InChIKey | KKMHLALTMNNESL-PVIHFLSJSA-N |
| XLogP | 5.90 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.65 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|