About methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate
methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate (PubChem CID 159164683) has the molecular formula C16H23ClN2O6S2
and a molecular weight of 438.96 g/mol. Its IUPAC name is methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate.
Molecular Properties
| Compound Name | methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate |
| PubChem CID | 159164683 |
| Molecular Formula | C16H23ClN2O6S2 |
| Molecular Weight | 438.96 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)Cl.Cc1ccc(CO)nc1.Cc1ccc(COS(C)(=O)=O)nc1 |
| InChI | InChI=1S/C8H11NO3S.C7H9NO.CH3ClO2S/c1-7-3-4-8(9-5-7)6-12-13(2,10)11;1-6-2-3-7(5-9)8-4-6;1-5(2,3)4/h3-5H,6H2,1-2H3;2-4,9H,5H2,1H3;1H3 |
| InChIKey | KKXQAHXEIQDWMS-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.96 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate?
The IUPAC name of methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate (CID 159164683) is methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate.
What is the SMILES notation for methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate?
The canonical SMILES for methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate is CS(=O)(=O)Cl.Cc1ccc(CO)nc1.Cc1ccc(COS(C)(=O)=O)nc1.
What is the InChIKey of methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate?
The InChIKey is KKXQAHXEIQDWMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO3S.C7H9NO.CH3ClO2S/c1-7-3-4-8(9-5-7)6-12-13(2,10)11;1-6-2-3-7(5-9)8-4-6;1-5(2,3)4/h3-5H,6H2,1-2H3;2-4,9H,5H2,1H3;1H3.
What are the key properties of methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate?
methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate has a molecular weight of 438.96 g/mol, XLogP of 1.93, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonyl chloride;(5-methyl-2-pyridinyl)methanol;(5-methyl-2-pyridinyl)methyl methanesulfonate is sourced from PubChem (CID 159164683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).