C11H15N3 — CID 15916607
2-[(3-methylphenyl)methyl]-3,4-dihydropyrazol-5-amine (PubChem CID 15916607) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-3,4-dihydropyrazol-5-amine.
| Compound Name | 2-[(3-methylphenyl)methyl]-3,4-dihydropyrazol-5-amine |
|---|---|
| PubChem CID | 15916607 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-3,4-dihydropyrazol-5-amine |
| SMILES | Cc1cccc(CN2CCC(N)=N2)c1 |
| InChI | InChI=1S/C11H15N3/c1-9-3-2-4-10(7-9)8-14-6-5-11(12)13-14/h2-4,7H,5-6,8H2,1H3,(H2,12,13) |
| InChIKey | JRLWTLWNVWSNGC-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |