About diethyl(propoxy)silane;ethyl(propoxy)silane
diethyl(propoxy)silane;ethyl(propoxy)silane (PubChem CID 159167086) has the molecular formula C12H32O2Si2
and a molecular weight of 264.56 g/mol. Its IUPAC name is diethyl(propoxy)silane;ethyl(propoxy)silane.
Molecular Properties
| Compound Name | diethyl(propoxy)silane;ethyl(propoxy)silane |
| PubChem CID | 159167086 |
| Molecular Formula | C12H32O2Si2 |
| Molecular Weight | 264.56 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | diethyl(propoxy)silane;ethyl(propoxy)silane |
| SMILES | CCCO[SiH2]CC.CCCO[SiH](CC)CC |
| InChI | InChI=1S/C7H18OSi.C5H14OSi/c1-4-7-8-9(5-2)6-3;1-3-5-6-7-4-2/h9H,4-7H2,1-3H3;3-5,7H2,1-2H3 |
| InChIKey | KLFBEHPCAAOXDS-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethyl(propoxy)silane;ethyl(propoxy)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl(propoxy)silane;ethyl(propoxy)silane?
The IUPAC name of diethyl(propoxy)silane;ethyl(propoxy)silane (CID 159167086) is diethyl(propoxy)silane;ethyl(propoxy)silane.
What is the SMILES notation for diethyl(propoxy)silane;ethyl(propoxy)silane?
The canonical SMILES for diethyl(propoxy)silane;ethyl(propoxy)silane is CCCO[SiH2]CC.CCCO[SiH](CC)CC.
What is the InChIKey of diethyl(propoxy)silane;ethyl(propoxy)silane?
The InChIKey is KLFBEHPCAAOXDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18OSi.C5H14OSi/c1-4-7-8-9(5-2)6-3;1-3-5-6-7-4-2/h9H,4-7H2,1-3H3;3-5,7H2,1-2H3.
What are the key properties of diethyl(propoxy)silane;ethyl(propoxy)silane?
diethyl(propoxy)silane;ethyl(propoxy)silane has a molecular weight of 264.56 g/mol, XLogP of 3.11, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl(propoxy)silane;ethyl(propoxy)silane is sourced from PubChem (CID 159167086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).