C22H29F4N3O5S — CID 159167591
tert-butyl (6R,9S)-9-[2-[3-fluoro-5-(3,3,3-trifluoro-2-oxopropyl)-4-pyridinyl]ethyl]-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decane-7-carboxylate (PubChem CID 159167591) has the molecular formula C22H29F4N3O5S and a molecular weight of 523.55 g/mol. Its IUPAC name is tert-butyl (6R,9S)-9-[2-[3-fluoro-5-(3,3,3-trifluoro-2-oxopropyl)-4-pyridinyl]ethyl]-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decane-7-carboxylate.
| Compound Name | tert-butyl (6R,9S)-9-[2-[3-fluoro-5-(3,3,3-trifluoro-2-oxopropyl)-4-pyridinyl]ethyl]-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decane-7-carboxylate |
|---|---|
| PubChem CID | 159167591 |
| Molecular Formula | C22H29F4N3O5S |
| Molecular Weight | 523.55 g/mol |
| Exact Mass | 523.18 |
| IUPAC Name | tert-butyl (6R,9S)-9-[2-[3-fluoro-5-(3,3,3-trifluoro-2-oxopropyl)-4-pyridinyl]ethyl]-2,2-dioxo-2λ6-thia-1,7-diazabicyclo[4.3.1]decane-7-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](CCc2c(F)cncc2CC(=O)C(F)(F)F)N2C[C@H]1CCCS2(=O)=O |
| InChI | InChI=1S/C22H29F4N3O5S/c1-21(2,3)34-20(31)28-12-16(29-13-15(28)5-4-8-35(29,32)33)6-7-17-14(10-27-11-18(17)23)9-19(30)22(24,25)26/h10-11,15-16H,4-9,12-13H2,1-3H3/t15-,16+/m1/s1 |
| InChIKey | CNESDBKYPYHVMZ-CVEARBPZSA-N |
| XLogP | 3.24 |
| TPSA | 96.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |