About CID 159169356
CID 159169356 (PubChem CID 159169356) has the molecular formula C26H22FN7O3S
and a molecular weight of 531.57 g/mol.
Molecular Properties
| Compound Name | CID 159169356 |
| PubChem CID | 159169356 |
| Molecular Formula | C26H22FN7O3S |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2cc(NC(=O)c3cnn4cccnc34)n(-c3ccc(C4CC4)cc3F)n2)cc1.N=S(=O)=O |
| InChI | InChI=1S/C26H21FN6O.HNO2S/c1-16-3-5-18(6-4-16)22-14-24(30-26(34)20-15-29-32-12-2-11-28-25(20)32)33(31-22)23-10-9-19(13-21(23)27)17-7-8-17;1-4(2)3/h2-6,9-15,17H,7-8H2,1H3,(H,30,34);1H |
| InChIKey | KLMFRXBZUHDNQB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze CID 159169356 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159169356?
The IUPAC name of CID 159169356 (CID 159169356) is not available.
What is the SMILES notation for CID 159169356?
The canonical SMILES for CID 159169356 is Cc1ccc(-c2cc(NC(=O)c3cnn4cccnc34)n(-c3ccc(C4CC4)cc3F)n2)cc1.N=S(=O)=O.
What is the InChIKey of CID 159169356?
The InChIKey is KLMFRXBZUHDNQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H21FN6O.HNO2S/c1-16-3-5-18(6-4-16)22-14-24(30-26(34)20-15-29-32-12-2-11-28-25(20)32)33(31-22)23-10-9-19(13-21(23)27)17-7-8-17;1-4(2)3/h2-6,9-15,17H,7-8H2,1H3,(H,30,34);1H.
What are the key properties of CID 159169356?
CID 159169356 has a molecular weight of 531.57 g/mol, XLogP of 4.79, 5 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159169356 is sourced from PubChem (CID 159169356), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).