C26H22FN7O3S — CID 159169356
CID 159169356 (PubChem CID 159169356) has the molecular formula C26H22FN7O3S and a molecular weight of 531.57 g/mol.
| Compound Name | CID 159169356 |
|---|---|
| PubChem CID | 159169356 |
| Molecular Formula | C26H22FN7O3S |
| Molecular Weight | 531.57 g/mol |
| Exact Mass | 531.15 |
| IUPAC Name | — |
| SMILES | Cc1ccc(-c2cc(NC(=O)c3cnn4cccnc34)n(-c3ccc(C4CC4)cc3F)n2)cc1.N=S(=O)=O |
| InChI | InChI=1S/C26H21FN6O.HNO2S/c1-16-3-5-18(6-4-16)22-14-24(30-26(34)20-15-29-32-12-2-11-28-25(20)32)33(31-22)23-10-9-19(13-21(23)27)17-7-8-17;1-4(2)3/h2-6,9-15,17H,7-8H2,1H3,(H,30,34);1H |
| InChIKey | KLMFRXBZUHDNQB-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 135.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.57 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |