About [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole
[4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole (PubChem CID 159171380) has the molecular formula C16H16F4N4O
and a molecular weight of 356.32 g/mol. Its IUPAC name is [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole.
Molecular Properties
| Compound Name | [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole |
| PubChem CID | 159171380 |
| Molecular Formula | C16H16F4N4O |
| Molecular Weight | 356.32 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole |
| SMILES | Cn1cccn1.Cn1nccc1C(O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C12H10F4N2O.C4H6N2/c1-18-10(4-5-17-18)11(19)8-3-2-7(13)6-9(8)12(14,15)16;1-6-4-2-3-5-6/h2-6,11,19H,1H3;2-4H,1H3 |
| InChIKey | KLSQANNVBBQKLJ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole?
The IUPAC name of [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole (CID 159171380) is [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole.
What is the SMILES notation for [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole?
The canonical SMILES for [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole is Cn1cccn1.Cn1nccc1C(O)c1ccc(F)cc1C(F)(F)F.
What is the InChIKey of [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole?
The InChIKey is KLSQANNVBBQKLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F4N2O.C4H6N2/c1-18-10(4-5-17-18)11(19)8-3-2-7(13)6-9(8)12(14,15)16;1-6-4-2-3-5-6/h2-6,11,19H,1H3;2-4H,1H3.
What are the key properties of [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole?
[4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole has a molecular weight of 356.32 g/mol, XLogP of 3.08, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-fluoro-2-(trifluoromethyl)phenyl]-(2-methylpyrazol-3-yl)methanol;1-methylpyrazole is sourced from PubChem (CID 159171380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).