C34H28Br2F2O4 — CID 159174587
[(E)-4-(4-bromo-2-fluorophenyl)-2-phenylbut-1-enyl] formate;(Z)-5-(4-bromo-2-fluorophenyl)-3-phenylpent-2-enoic acid (PubChem CID 159174587) has the molecular formula C34H28Br2F2O4 and a molecular weight of 698.40 g/mol. Its IUPAC name is [(E)-4-(4-bromo-2-fluorophenyl)-2-phenylbut-1-enyl] formate;(Z)-5-(4-bromo-2-fluorophenyl)-3-phenylpent-2-enoic acid.
| Compound Name | [(E)-4-(4-bromo-2-fluorophenyl)-2-phenylbut-1-enyl] formate;(Z)-5-(4-bromo-2-fluorophenyl)-3-phenylpent-2-enoic acid |
|---|---|
| PubChem CID | 159174587 |
| Molecular Formula | C34H28Br2F2O4 |
| Molecular Weight | 698.40 g/mol |
| Exact Mass | 696.03 |
| IUPAC Name | [(E)-4-(4-bromo-2-fluorophenyl)-2-phenylbut-1-enyl] formate;(Z)-5-(4-bromo-2-fluorophenyl)-3-phenylpent-2-enoic acid |
| SMILES | O=C(O)/C=C(/CCc1ccc(Br)cc1F)c1ccccc1.O=CO/C=C(\CCc1ccc(Br)cc1F)c1ccccc1 |
| InChI | InChI=1S/2C17H14BrFO2/c18-16-9-8-14(17(19)10-16)6-7-15(11-21-12-20)13-4-2-1-3-5-13;18-15-9-8-13(16(19)11-15)6-7-14(10-17(20)21)12-4-2-1-3-5-12/h1-5,8-12H,6-7H2;1-5,8-11H,6-7H2,(H,20,21)/b15-11+;14-10- |
| InChIKey | KMCQGHSYVHCSQY-VVUXTCSUSA-N |
| XLogP | 9.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.40 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|