C18H17Cl2F3N4O2S2Si — CID 159176948
4-chlorothieno[3,2-d]pyrimidine-6-carbaldehyde;1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanol;trimethylsilane (PubChem CID 159176948) has the molecular formula C18H17Cl2F3N4O2S2Si and a molecular weight of 541.48 g/mol. Its IUPAC name is 4-chlorothieno[3,2-d]pyrimidine-6-carbaldehyde;1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanol;trimethylsilane.
| Compound Name | 4-chlorothieno[3,2-d]pyrimidine-6-carbaldehyde;1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanol;trimethylsilane |
|---|---|
| PubChem CID | 159176948 |
| Molecular Formula | C18H17Cl2F3N4O2S2Si |
| Molecular Weight | 541.48 g/mol |
| Exact Mass | 539.99 |
| IUPAC Name | 4-chlorothieno[3,2-d]pyrimidine-6-carbaldehyde;1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanol;trimethylsilane |
| SMILES | C[SiH](C)C.O=Cc1cc2ncnc(Cl)c2s1.OC(c1cc2ncnc(Cl)c2s1)C(F)(F)F |
| InChI | InChI=1S/C8H4ClF3N2OS.C7H3ClN2OS.C3H10Si/c9-7-5-3(13-2-14-7)1-4(16-5)6(15)8(10,11)12;8-7-6-5(9-3-10-7)1-4(2-11)12-6;1-4(2)3/h1-2,6,15H;1-3H;4H,1-3H3 |
| InChIKey | KMKAKLHHUPISBA-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 88.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.48 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|