C19H16Cl2F6N4O2S2Si — CID 161421297
1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanol;[1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethoxy]-trimethylsilane (PubChem CID 161421297) has the molecular formula C19H16Cl2F6N4O2S2Si and a molecular weight of 609.48 g/mol. Its IUPAC name is 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanol;[1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethoxy]-trimethylsilane.
| Compound Name | 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanol;[1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethoxy]-trimethylsilane |
|---|---|
| PubChem CID | 161421297 |
| Molecular Formula | C19H16Cl2F6N4O2S2Si |
| Molecular Weight | 609.48 g/mol |
| Exact Mass | 607.98 |
| IUPAC Name | 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethanol;[1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)-2,2,2-trifluoroethoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1cc2ncnc(Cl)c2s1)C(F)(F)F.OC(c1cc2ncnc(Cl)c2s1)C(F)(F)F |
| InChI | InChI=1S/C11H12ClF3N2OSSi.C8H4ClF3N2OS/c1-20(2,3)18-9(11(13,14)15)7-4-6-8(19-7)10(12)17-5-16-6;9-7-5-3(13-2-14-7)1-4(16-5)6(15)8(10,11)12/h4-5,9H,1-3H3;1-2,6,15H |
| InChIKey | VWTRPMXRGMQVAK-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 81.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.48 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|