C8H7ClN2OS — CID 151157827
1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)ethanol (PubChem CID 151157827) has the molecular formula C8H7ClN2OS and a molecular weight of 214.68 g/mol. Its IUPAC name is 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)ethanol.
| Compound Name | 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)ethanol |
|---|---|
| PubChem CID | 151157827 |
| Molecular Formula | C8H7ClN2OS |
| Molecular Weight | 214.68 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | 1-(4-chlorothieno[3,2-d]pyrimidin-6-yl)ethanol |
| SMILES | CC(O)c1cc2ncnc(Cl)c2s1 |
| InChI | InChI=1S/C8H7ClN2OS/c1-4(12)6-2-5-7(13-6)8(9)11-3-10-5/h2-4,12H,1H3 |
| InChIKey | MZPRHOGUIGXGGD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.68 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |