C31H31N5O3S — CID 159180379
tert-butyl 2-[(6R)-2-[[3-[[4-(4-cyanophenyl)pyrazol-1-yl]methyl]benzoyl]amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]acetate (PubChem CID 159180379) has the molecular formula C31H31N5O3S and a molecular weight of 553.69 g/mol. Its IUPAC name is tert-butyl 2-[(6R)-2-[[3-[[4-(4-cyanophenyl)pyrazol-1-yl]methyl]benzoyl]amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]acetate.
| Compound Name | tert-butyl 2-[(6R)-2-[[3-[[4-(4-cyanophenyl)pyrazol-1-yl]methyl]benzoyl]amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]acetate |
|---|---|
| PubChem CID | 159180379 |
| Molecular Formula | C31H31N5O3S |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | tert-butyl 2-[(6R)-2-[[3-[[4-(4-cyanophenyl)pyrazol-1-yl]methyl]benzoyl]amino]-4,5,6,7-tetrahydro-1,3-benzothiazol-6-yl]acetate |
| SMILES | CC(C)(C)OC(=O)C[C@H]1CCc2nc(NC(=O)c3cccc(Cn4cc(-c5ccc(C#N)cc5)cn4)c3)sc2C1 |
| InChI | InChI=1S/C31H31N5O3S/c1-31(2,3)39-28(37)15-21-9-12-26-27(14-21)40-30(34-26)35-29(38)24-6-4-5-22(13-24)18-36-19-25(17-33-36)23-10-7-20(16-32)8-11-23/h4-8,10-11,13,17,19,21H,9,12,14-15,18H2,1-3H3,(H,34,35,38)/t21-/m0/s1 |
| InChIKey | KMURRYPMBPQHJX-NRFANRHFSA-N |
| XLogP | 6.02 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |