C21H25FN8O4 — CID 159180580
N-(4,5-dihydroimidazol-1-yl)-4-ethyl-2-fluoro-1H-benzimidazol-5-amine;3-ethyl-6-methyl-2,4-dinitroaniline (PubChem CID 159180580) has the molecular formula C21H25FN8O4 and a molecular weight of 472.48 g/mol. Its IUPAC name is N-(4,5-dihydroimidazol-1-yl)-4-ethyl-2-fluoro-1H-benzimidazol-5-amine;3-ethyl-6-methyl-2,4-dinitroaniline.
| Compound Name | N-(4,5-dihydroimidazol-1-yl)-4-ethyl-2-fluoro-1H-benzimidazol-5-amine;3-ethyl-6-methyl-2,4-dinitroaniline |
|---|---|
| PubChem CID | 159180580 |
| Molecular Formula | C21H25FN8O4 |
| Molecular Weight | 472.48 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | N-(4,5-dihydroimidazol-1-yl)-4-ethyl-2-fluoro-1H-benzimidazol-5-amine;3-ethyl-6-methyl-2,4-dinitroaniline |
| SMILES | CCc1c(NN2C=NCC2)ccc2[nH]c(F)nc12.CCc1c([N+](=O)[O-])cc(C)c(N)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14FN5.C9H11N3O4/c1-2-8-9(17-18-6-5-14-7-18)3-4-10-11(8)16-12(13)15-10;1-3-6-7(11(13)14)4-5(2)8(10)9(6)12(15)16/h3-4,7,17H,2,5-6H2,1H3,(H,15,16);4H,3,10H2,1-2H3 |
| InChIKey | KMVITRNRNGJAHX-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 168.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.48 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|