About 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane
3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane (PubChem CID 159182370) has the molecular formula C14H20O2
and a molecular weight of 220.31 g/mol. Its IUPAC name is 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane.
Molecular Properties
| Compound Name | 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane |
| PubChem CID | 159182370 |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 g/mol |
| Exact Mass | 220.15 |
| IUPAC Name | 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane |
| SMILES | C.CC(C)(C)CC1OC(=O)c2ccccc21 |
| InChI | InChI=1S/C13H16O2.CH4/c1-13(2,3)8-11-9-6-4-5-7-10(9)12(14)15-11;/h4-7,11H,8H2,1-3H3;1H4 |
| InChIKey | KNBHWOUWWAYBGG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.31 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane?
The IUPAC name of 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane (CID 159182370) is 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane.
What is the SMILES notation for 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane?
The canonical SMILES for 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane is C.CC(C)(C)CC1OC(=O)c2ccccc21.
What is the InChIKey of 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane?
The InChIKey is KNBHWOUWWAYBGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2.CH4/c1-13(2,3)8-11-9-6-4-5-7-10(9)12(14)15-11;/h4-7,11H,8H2,1-3H3;1H4.
What are the key properties of 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane?
3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane has a molecular weight of 220.31 g/mol, XLogP of 3.97, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-dimethylpropyl)-3H-2-benzofuran-1-one;methane is sourced from PubChem (CID 159182370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).