C25H34N3O14+ — CID 159183208
2-ethyl-6-(2-nitrophenoxy)oxane-3,4,5-triol;[3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methylazanium (PubChem CID 159183208) has the molecular formula C25H34N3O14+ and a molecular weight of 600.55 g/mol. Its IUPAC name is 2-ethyl-6-(2-nitrophenoxy)oxane-3,4,5-triol;[3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methylazanium.
| Compound Name | 2-ethyl-6-(2-nitrophenoxy)oxane-3,4,5-triol;[3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methylazanium |
|---|---|
| PubChem CID | 159183208 |
| Molecular Formula | C25H34N3O14+ |
| Molecular Weight | 600.55 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 2-ethyl-6-(2-nitrophenoxy)oxane-3,4,5-triol;[3,4,5-trihydroxy-6-(4-nitrophenoxy)oxan-2-yl]methylazanium |
| SMILES | CCC1OC(Oc2ccccc2[N+](=O)[O-])C(O)C(O)C1O.[NH3+]CC1OC(Oc2ccc([N+](=O)[O-])cc2)C(O)C(O)C1O |
| InChI | InChI=1S/C13H17NO7.C12H16N2O7/c1-2-8-10(15)11(16)12(17)13(20-8)21-9-6-4-3-5-7(9)14(18)19;13-5-8-9(15)10(16)11(17)12(21-8)20-7-3-1-6(2-4-7)14(18)19/h3-6,8,10-13,15-17H,2H2,1H3;1-4,8-12,15-17H,5,13H2/p+1 |
| InChIKey | KNDVOHWJEDEAOX-UHFFFAOYSA-O |
| XLogP | -1.79 |
| TPSA | 272.22 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.55 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|