About ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate
ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate (PubChem CID 159184038) has the molecular formula C11H23N3O4
and a molecular weight of 261.32 g/mol. Its IUPAC name is ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate.
Molecular Properties
| Compound Name | ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate |
| PubChem CID | 159184038 |
| Molecular Formula | C11H23N3O4 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate |
| SMILES | CCOC(=O)C/N=C/N(C)C.CCOC(=O)CN |
| InChI | InChI=1S/C7H14N2O2.C4H9NO2/c1-4-11-7(10)5-8-6-9(2)3;1-2-7-4(6)3-5/h6H,4-5H2,1-3H3;2-3,5H2,1H3/b8-6+; |
| InChIKey | KNGIIPBFWQFPGD-WVLIHFOGSA-N |
| XLogP | -0.35 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate?
The IUPAC name of ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate (CID 159184038) is ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate.
What is the SMILES notation for ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate?
The canonical SMILES for ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate is CCOC(=O)C/N=C/N(C)C.CCOC(=O)CN.
What is the InChIKey of ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate?
The InChIKey is KNGIIPBFWQFPGD-WVLIHFOGSA-N. The full InChI is InChI=1S/C7H14N2O2.C4H9NO2/c1-4-11-7(10)5-8-6-9(2)3;1-2-7-4(6)3-5/h6H,4-5H2,1-3H3;2-3,5H2,1H3/b8-6+;.
What are the key properties of ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate?
ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate has a molecular weight of 261.32 g/mol, XLogP of -0.35, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-aminoacetate;ethyl 2-(dimethylaminomethylideneamino)acetate is sourced from PubChem (CID 159184038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).