C28H41Br2IN6O4 — CID 159187879
5-bromo-2-iodopyridine;tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate (PubChem CID 159187879) has the molecular formula C28H41Br2IN6O4 and a molecular weight of 812.39 g/mol. Its IUPAC name is 5-bromo-2-iodopyridine;tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate.
| Compound Name | 5-bromo-2-iodopyridine;tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 159187879 |
| Molecular Formula | C28H41Br2IN6O4 |
| Molecular Weight | 812.39 g/mol |
| Exact Mass | 810.06 |
| IUPAC Name | 5-bromo-2-iodopyridine;tert-butyl 4-(5-bromo-2-pyridinyl)piperazine-1-carboxylate;tert-butyl piperazine-1-carboxylate |
| SMILES | Brc1ccc(I)nc1.CC(C)(C)OC(=O)N1CCN(c2ccc(Br)cn2)CC1.CC(C)(C)OC(=O)N1CCNCC1 |
| InChI | InChI=1S/C14H20BrN3O2.C9H18N2O2.C5H3BrIN/c1-14(2,3)20-13(19)18-8-6-17(7-9-18)12-5-4-11(15)10-16-12;1-9(2,3)13-8(12)11-6-4-10-5-7-11;6-4-1-2-5(7)8-3-4/h4-5,10H,6-9H2,1-3H3;10H,4-7H2,1-3H3;1-3H |
| InChIKey | KNSINPSDYBVTRK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 812.39 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|