C40H80O3S — CID 159188433
1,1-ditert-butylcyclohexane;4,4-ditert-butyloxane;4,4-ditert-butylthiane 1,1-dioxide (PubChem CID 159188433) has the molecular formula C40H80O3S and a molecular weight of 641.14 g/mol. Its IUPAC name is 1,1-ditert-butylcyclohexane;4,4-ditert-butyloxane;4,4-ditert-butylthiane 1,1-dioxide.
| Compound Name | 1,1-ditert-butylcyclohexane;4,4-ditert-butyloxane;4,4-ditert-butylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 159188433 |
| Molecular Formula | C40H80O3S |
| Molecular Weight | 641.14 g/mol |
| Exact Mass | 640.58 |
| IUPAC Name | 1,1-ditert-butylcyclohexane;4,4-ditert-butyloxane;4,4-ditert-butylthiane 1,1-dioxide |
| SMILES | CC(C)(C)C1(C(C)(C)C)CCCCC1.CC(C)(C)C1(C(C)(C)C)CCOCC1.CC(C)(C)C1(C(C)(C)C)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C14H28.C13H26O2S.C13H26O/c1-12(2,3)14(13(4,5)6)10-8-7-9-11-14;1-11(2,3)13(12(4,5)6)7-9-16(14,15)10-8-13;1-11(2,3)13(12(4,5)6)7-9-14-10-8-13/h7-11H2,1-6H3;7-10H2,1-6H3;7-10H2,1-6H3 |
| InChIKey | KNTYQOXGYWXZFJ-UHFFFAOYSA-N |
| XLogP | 12.18 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.14 |
| LogP ≤ 5 | 12.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |