C11H24N2O5S — CID 159189227
N-(2-methoxyethyl)acetamide;N-methyl-N-(2-methylsulfonylethyl)acetamide (PubChem CID 159189227) has the molecular formula C11H24N2O5S and a molecular weight of 296.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)acetamide;N-methyl-N-(2-methylsulfonylethyl)acetamide.
| Compound Name | N-(2-methoxyethyl)acetamide;N-methyl-N-(2-methylsulfonylethyl)acetamide |
|---|---|
| PubChem CID | 159189227 |
| Molecular Formula | C11H24N2O5S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-(2-methoxyethyl)acetamide;N-methyl-N-(2-methylsulfonylethyl)acetamide |
| SMILES | CC(=O)N(C)CCS(C)(=O)=O.COCCNC(C)=O |
| InChI | InChI=1S/C6H13NO3S.C5H11NO2/c1-6(8)7(2)4-5-11(3,9)10;1-5(7)6-3-4-8-2/h4-5H2,1-3H3;3-4H2,1-2H3,(H,6,7) |
| InChIKey | KNWKBUUDPZTOJW-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|